C32H23F3N2O3 — CID 68813456
2-[4-[[4-[3-benzoyl-8-(trifluoromethyl)quinolin-4-yl]anilino]methyl]phenyl]acetic acid (PubChem CID 68813456) has the molecular formula C32H23F3N2O3 and a molecular weight of 540.54 g/mol. Its IUPAC name is 2-[4-[[4-[3-benzoyl-8-(trifluoromethyl)quinolin-4-yl]anilino]methyl]phenyl]acetic acid.
| Compound Name | 2-[4-[[4-[3-benzoyl-8-(trifluoromethyl)quinolin-4-yl]anilino]methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 68813456 |
| Molecular Formula | C32H23F3N2O3 |
| Molecular Weight | 540.54 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | 2-[4-[[4-[3-benzoyl-8-(trifluoromethyl)quinolin-4-yl]anilino]methyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(CNc2ccc(-c3c(C(=O)c4ccccc4)cnc4c(C(F)(F)F)cccc34)cc2)cc1 |
| InChI | InChI=1S/C32H23F3N2O3/c33-32(34,35)27-8-4-7-25-29(26(19-37-30(25)27)31(40)23-5-2-1-3-6-23)22-13-15-24(16-14-22)36-18-21-11-9-20(10-12-21)17-28(38)39/h1-16,19,36H,17-18H2,(H,38,39) |
| InChIKey | KJDNLRRPPJVNLT-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.54 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |