C31H24ClN3O2 — CID 66913529
1-[3-(3-benzoyl-8-chloroquinolin-4-yl)phenyl]-3-(2,6-dimethylphenyl)urea (PubChem CID 66913529) has the molecular formula C31H24ClN3O2 and a molecular weight of 506.01 g/mol. Its IUPAC name is 1-[3-(3-benzoyl-8-chloroquinolin-4-yl)phenyl]-3-(2,6-dimethylphenyl)urea.
| Compound Name | 1-[3-(3-benzoyl-8-chloroquinolin-4-yl)phenyl]-3-(2,6-dimethylphenyl)urea |
|---|---|
| PubChem CID | 66913529 |
| Molecular Formula | C31H24ClN3O2 |
| Molecular Weight | 506.01 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | 1-[3-(3-benzoyl-8-chloroquinolin-4-yl)phenyl]-3-(2,6-dimethylphenyl)urea |
| SMILES | Cc1cccc(C)c1NC(=O)Nc1cccc(-c2c(C(=O)c3ccccc3)cnc3c(Cl)cccc23)c1 |
| InChI | InChI=1S/C31H24ClN3O2/c1-19-9-6-10-20(2)28(19)35-31(37)34-23-14-7-13-22(17-23)27-24-15-8-16-26(32)29(24)33-18-25(27)30(36)21-11-4-3-5-12-21/h3-18H,1-2H3,(H2,34,35,37) |
| InChIKey | AGDXCPKEITXOGI-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.01 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |