C25H21Cl2N3O2 — CID 141203979
1-(2-chloroethyl)-3-[3-[3-(8-chloro-3-methylquinolin-4-yl)phenoxy]phenyl]urea (PubChem CID 141203979) has the molecular formula C25H21Cl2N3O2 and a molecular weight of 466.37 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-[3-[3-(8-chloro-3-methylquinolin-4-yl)phenoxy]phenyl]urea.
| Compound Name | 1-(2-chloroethyl)-3-[3-[3-(8-chloro-3-methylquinolin-4-yl)phenoxy]phenyl]urea |
|---|---|
| PubChem CID | 141203979 |
| Molecular Formula | C25H21Cl2N3O2 |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 1-(2-chloroethyl)-3-[3-[3-(8-chloro-3-methylquinolin-4-yl)phenoxy]phenyl]urea |
| SMILES | Cc1cnc2c(Cl)cccc2c1-c1cccc(Oc2cccc(NC(=O)NCCCl)c2)c1 |
| InChI | InChI=1S/C25H21Cl2N3O2/c1-16-15-29-24-21(9-4-10-22(24)27)23(16)17-5-2-7-19(13-17)32-20-8-3-6-18(14-20)30-25(31)28-12-11-26/h2-10,13-15H,11-12H2,1H3,(H2,28,30,31) |
| InChIKey | UWTWTVPYONAHSU-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|