C26H24ClN3O3S — CID 68877452
8-chloro-3-methyl-4-[3-(3-piperazin-1-ylsulfonylphenoxy)phenyl]quinoline (PubChem CID 68877452) has the molecular formula C26H24ClN3O3S and a molecular weight of 494.02 g/mol. Its IUPAC name is 8-chloro-3-methyl-4-[3-(3-piperazin-1-ylsulfonylphenoxy)phenyl]quinoline.
| Compound Name | 8-chloro-3-methyl-4-[3-(3-piperazin-1-ylsulfonylphenoxy)phenyl]quinoline |
|---|---|
| PubChem CID | 68877452 |
| Molecular Formula | C26H24ClN3O3S |
| Molecular Weight | 494.02 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | 8-chloro-3-methyl-4-[3-(3-piperazin-1-ylsulfonylphenoxy)phenyl]quinoline |
| SMILES | Cc1cnc2c(Cl)cccc2c1-c1cccc(Oc2cccc(S(=O)(=O)N3CCNCC3)c2)c1 |
| InChI | InChI=1S/C26H24ClN3O3S/c1-18-17-29-26-23(9-4-10-24(26)27)25(18)19-5-2-6-20(15-19)33-21-7-3-8-22(16-21)34(31,32)30-13-11-28-12-14-30/h2-10,15-17,28H,11-14H2,1H3 |
| InChIKey | KQNWTGDQTBQKJC-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.02 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |