C26H23ClN2O3S — CID 68876274
8-chloro-3-methyl-4-[3-(4-pyrrolidin-1-ylsulfonylphenoxy)phenyl]quinoline (PubChem CID 68876274) has the molecular formula C26H23ClN2O3S and a molecular weight of 479.00 g/mol. Its IUPAC name is 8-chloro-3-methyl-4-[3-(4-pyrrolidin-1-ylsulfonylphenoxy)phenyl]quinoline.
| Compound Name | 8-chloro-3-methyl-4-[3-(4-pyrrolidin-1-ylsulfonylphenoxy)phenyl]quinoline |
|---|---|
| PubChem CID | 68876274 |
| Molecular Formula | C26H23ClN2O3S |
| Molecular Weight | 479.00 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | 8-chloro-3-methyl-4-[3-(4-pyrrolidin-1-ylsulfonylphenoxy)phenyl]quinoline |
| SMILES | Cc1cnc2c(Cl)cccc2c1-c1cccc(Oc2ccc(S(=O)(=O)N3CCCC3)cc2)c1 |
| InChI | InChI=1S/C26H23ClN2O3S/c1-18-17-28-26-23(8-5-9-24(26)27)25(18)19-6-4-7-21(16-19)32-20-10-12-22(13-11-20)33(30,31)29-14-2-3-15-29/h4-13,16-17H,2-3,14-15H2,1H3 |
| InChIKey | KGGYGANOYITZMY-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.00 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |