C11H12O4 — CID 175268870
bicyclo[3.1.0]hexa-1,3,5-trien-2-ol;methyl 2-methoxyprop-2-enoate (PubChem CID 175268870) has the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. Its IUPAC name is bicyclo[3.1.0]hexa-1,3,5-trien-2-ol;methyl 2-methoxyprop-2-enoate.
| Compound Name | bicyclo[3.1.0]hexa-1,3,5-trien-2-ol;methyl 2-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 175268870 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | bicyclo[3.1.0]hexa-1,3,5-trien-2-ol;methyl 2-methoxyprop-2-enoate |
| SMILES | C=C(OC)C(=O)OC.Oc1ccc2cc1-2 |
| InChI | InChI=1S/C6H4O.C5H8O3/c7-6-2-1-4-3-5(4)6;1-4(7-2)5(6)8-3/h1-3,7H;1H2,2-3H3 |
| InChIKey | BTHZHJHQXNULEU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|