C13H10ClFN2 — CID 175273352
5-(2-chloro-6-fluorophenyl)-2,4-dihydro-1H-indazole (PubChem CID 175273352) has the molecular formula C13H10ClFN2 and a molecular weight of 248.69 g/mol. Its IUPAC name is 5-(2-chloro-6-fluorophenyl)-2,4-dihydro-1H-indazole.
| Compound Name | 5-(2-chloro-6-fluorophenyl)-2,4-dihydro-1H-indazole |
|---|---|
| PubChem CID | 175273352 |
| Molecular Formula | C13H10ClFN2 |
| Molecular Weight | 248.69 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 5-(2-chloro-6-fluorophenyl)-2,4-dihydro-1H-indazole |
| SMILES | Fc1cccc(Cl)c1C1=CC=C2NNC=C2C1 |
| InChI | InChI=1S/C13H10ClFN2/c14-10-2-1-3-11(15)13(10)8-4-5-12-9(6-8)7-16-17-12/h1-5,7,16-17H,6H2 |
| InChIKey | NSQPJSYLHPMAIR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.69 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |