C22H42N4O7 — CID 175275517
(2R,6S)-6-amino-2-(hexanoylamino)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (PubChem CID 175275517) has the molecular formula C22H42N4O7 and a molecular weight of 474.60 g/mol. Its IUPAC name is (2R,6S)-6-amino-2-(hexanoylamino)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid.
| Compound Name | (2R,6S)-6-amino-2-(hexanoylamino)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 175275517 |
| Molecular Formula | C22H42N4O7 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.31 |
| IUPAC Name | (2R,6S)-6-amino-2-(hexanoylamino)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| SMILES | CCCCCC(=O)N[C@](CCC[C@@H](N)NC(=O)OC(C)(C)C)(NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C22H42N4O7/c1-8-9-10-13-16(27)25-22(17(28)29,26-19(31)33-21(5,6)7)14-11-12-15(23)24-18(30)32-20(2,3)4/h15H,8-14,23H2,1-7H3,(H,24,30)(H,25,27)(H,26,31)(H,28,29)/t15-,22+/m0/s1 |
| InChIKey | QYWZTIMOKYTHRO-OYHNWAKOSA-N |
| XLogP | 2.97 |
| TPSA | 169.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|