C17H26FNO3 — CID 175286879
tert-butyl formate;1-(4-fluorophenyl)-2-methylpiperidin-4-ol (PubChem CID 175286879) has the molecular formula C17H26FNO3 and a molecular weight of 311.40 g/mol. Its IUPAC name is tert-butyl formate;1-(4-fluorophenyl)-2-methylpiperidin-4-ol.
| Compound Name | tert-butyl formate;1-(4-fluorophenyl)-2-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 175286879 |
| Molecular Formula | C17H26FNO3 |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | tert-butyl formate;1-(4-fluorophenyl)-2-methylpiperidin-4-ol |
| SMILES | CC(C)(C)OC=O.CC1CC(O)CCN1c1ccc(F)cc1 |
| InChI | InChI=1S/C12H16FNO.C5H10O2/c1-9-8-12(15)6-7-14(9)11-4-2-10(13)3-5-11;1-5(2,3)7-4-6/h2-5,9,12,15H,6-8H2,1H3;4H,1-3H3 |
| InChIKey | GYTKJJKCZCFXBG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|