C34H46N4O5Si — CID 175289263
4-[1-[[6-[3-(2-ethoxyphenoxy)piperidin-1-yl]pyrazin-2-yl]amino]-1-oxo-5-trimethylsilylpentan-3-yl]-2,6-dimethylbenzoic acid (PubChem CID 175289263) has the molecular formula C34H46N4O5Si and a molecular weight of 618.85 g/mol. Its IUPAC name is 4-[1-[[6-[3-(2-ethoxyphenoxy)piperidin-1-yl]pyrazin-2-yl]amino]-1-oxo-5-trimethylsilylpentan-3-yl]-2,6-dimethylbenzoic acid.
| Compound Name | 4-[1-[[6-[3-(2-ethoxyphenoxy)piperidin-1-yl]pyrazin-2-yl]amino]-1-oxo-5-trimethylsilylpentan-3-yl]-2,6-dimethylbenzoic acid |
|---|---|
| PubChem CID | 175289263 |
| Molecular Formula | C34H46N4O5Si |
| Molecular Weight | 618.85 g/mol |
| Exact Mass | 618.32 |
| IUPAC Name | 4-[1-[[6-[3-(2-ethoxyphenoxy)piperidin-1-yl]pyrazin-2-yl]amino]-1-oxo-5-trimethylsilylpentan-3-yl]-2,6-dimethylbenzoic acid |
| SMILES | CCOc1ccccc1OC1CCCN(c2cncc(NC(=O)CC(CC[Si](C)(C)C)c3cc(C)c(C(=O)O)c(C)c3)n2)C1 |
| InChI | InChI=1S/C34H46N4O5Si/c1-7-42-28-12-8-9-13-29(28)43-27-11-10-15-38(22-27)31-21-35-20-30(36-31)37-32(39)19-25(14-16-44(4,5)6)26-17-23(2)33(34(40)41)24(3)18-26/h8-9,12-13,17-18,20-21,25,27H,7,10-11,14-16,19,22H2,1-6H3,(H,40,41)(H,36,37,39) |
| InChIKey | IVGGQPGAMLGHNY-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 113.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.85 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|