C18H20BrNO4 — CID 175291650
3-bromopropanamide;methyl benzoate;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene (PubChem CID 175291650) has the molecular formula C18H20BrNO4 and a molecular weight of 394.27 g/mol. Its IUPAC name is 3-bromopropanamide;methyl benzoate;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene.
| Compound Name | 3-bromopropanamide;methyl benzoate;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene |
|---|---|
| PubChem CID | 175291650 |
| Molecular Formula | C18H20BrNO4 |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 3-bromopropanamide;methyl benzoate;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene |
| SMILES | COC(=O)c1ccccc1.NC(=O)CCBr.c1cc2cc(c1)OC2 |
| InChI | InChI=1S/C8H8O2.C7H6O.C3H6BrNO/c1-10-8(9)7-5-3-2-4-6-7;1-2-6-4-7(3-1)8-5-6;4-2-1-3(5)6/h2-6H,1H3;1-4H,5H2;1-2H2,(H2,5,6) |
| InChIKey | VEBAFGZZBAGXDU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|