C13H18FN5 — CID 175292944
N'-[N'-(3-fluorophenyl)carbamimidoyl]piperidine-2-carboximidamide (PubChem CID 175292944) has the molecular formula C13H18FN5 and a molecular weight of 263.32 g/mol. Its IUPAC name is N'-[N'-(3-fluorophenyl)carbamimidoyl]piperidine-2-carboximidamide.
| Compound Name | N'-[N'-(3-fluorophenyl)carbamimidoyl]piperidine-2-carboximidamide |
|---|---|
| PubChem CID | 175292944 |
| Molecular Formula | C13H18FN5 |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | N'-[N'-(3-fluorophenyl)carbamimidoyl]piperidine-2-carboximidamide |
| SMILES | NC(=N/C(N)=N/c1cccc(F)c1)C1CCCCN1 |
| InChI | InChI=1S/C13H18FN5/c14-9-4-3-5-10(8-9)18-13(16)19-12(15)11-6-1-2-7-17-11/h3-5,8,11,17H,1-2,6-7H2,(H4,15,16,18,19) |
| InChIKey | SXUVOYJFDIQXGU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|