C34H39N3O4 — CID 175303960
methyl (2S)-3-methyl-2-[methyl-[1-[(2R)-1-tritylazetidine-2-carbonyl]azetidine-3-carbonyl]amino]butanoate (PubChem CID 175303960) has the molecular formula C34H39N3O4 and a molecular weight of 553.70 g/mol. Its IUPAC name is methyl (2S)-3-methyl-2-[methyl-[1-[(2R)-1-tritylazetidine-2-carbonyl]azetidine-3-carbonyl]amino]butanoate.
| Compound Name | methyl (2S)-3-methyl-2-[methyl-[1-[(2R)-1-tritylazetidine-2-carbonyl]azetidine-3-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 175303960 |
| Molecular Formula | C34H39N3O4 |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.29 |
| IUPAC Name | methyl (2S)-3-methyl-2-[methyl-[1-[(2R)-1-tritylazetidine-2-carbonyl]azetidine-3-carbonyl]amino]butanoate |
| SMILES | COC(=O)[C@H](C(C)C)N(C)C(=O)C1CN(C(=O)[C@H]2CCN2C(c2ccccc2)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C34H39N3O4/c1-24(2)30(33(40)41-4)35(3)31(38)25-22-36(23-25)32(39)29-20-21-37(29)34(26-14-8-5-9-15-26,27-16-10-6-11-17-27)28-18-12-7-13-19-28/h5-19,24-25,29-30H,20-23H2,1-4H3/t29-,30+/m1/s1 |
| InChIKey | BJAPIUUZPADJRG-IHLOFXLRSA-N |
| XLogP | 4.17 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|