C39H44N4O4 — CID 175396470
methyl (2S)-3-methyl-2-[methyl-[4-(1-tritylazepine-2-carbonyl)-1,4-diazepane-1-carbonyl]amino]butanoate (PubChem CID 175396470) has the molecular formula C39H44N4O4 and a molecular weight of 632.81 g/mol. Its IUPAC name is methyl (2S)-3-methyl-2-[methyl-[4-(1-tritylazepine-2-carbonyl)-1,4-diazepane-1-carbonyl]amino]butanoate.
| Compound Name | methyl (2S)-3-methyl-2-[methyl-[4-(1-tritylazepine-2-carbonyl)-1,4-diazepane-1-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 175396470 |
| Molecular Formula | C39H44N4O4 |
| Molecular Weight | 632.81 g/mol |
| Exact Mass | 632.34 |
| IUPAC Name | methyl (2S)-3-methyl-2-[methyl-[4-(1-tritylazepine-2-carbonyl)-1,4-diazepane-1-carbonyl]amino]butanoate |
| SMILES | COC(=O)[C@H](C(C)C)N(C)C(=O)N1CCCN(C(=O)C2=CC=CC=CN2C(c2ccccc2)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C39H44N4O4/c1-30(2)35(37(45)47-4)40(3)38(46)42-26-17-25-41(28-29-42)36(44)34-24-15-8-16-27-43(34)39(31-18-9-5-10-19-31,32-20-11-6-12-21-32)33-22-13-7-14-23-33/h5-16,18-24,27,30,35H,17,25-26,28-29H2,1-4H3/t35-/m0/s1 |
| InChIKey | ZJCOXWFLRXZJIF-DHUJRADRSA-N |
| XLogP | 6.03 |
| TPSA | 73.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.81 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|