C20H28ClNO2 — CID 175311496
2-(4-acetyl-1-butylcyclohexyl)-N-(4-chlorophenyl)acetamide (PubChem CID 175311496) has the molecular formula C20H28ClNO2 and a molecular weight of 349.90 g/mol. Its IUPAC name is 2-(4-acetyl-1-butylcyclohexyl)-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-(4-acetyl-1-butylcyclohexyl)-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 175311496 |
| Molecular Formula | C20H28ClNO2 |
| Molecular Weight | 349.90 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 2-(4-acetyl-1-butylcyclohexyl)-N-(4-chlorophenyl)acetamide |
| SMILES | CCCCC1(CC(=O)Nc2ccc(Cl)cc2)CCC(C(C)=O)CC1 |
| InChI | InChI=1S/C20H28ClNO2/c1-3-4-11-20(12-9-16(10-13-20)15(2)23)14-19(24)22-18-7-5-17(21)6-8-18/h5-8,16H,3-4,9-14H2,1-2H3,(H,22,24) |
| InChIKey | MMKFZOINQZPFQZ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.90 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |