About 1H-imidazole;sulfuryl difluoride;trifluoromethanesulfonic acid
1H-imidazole;sulfuryl difluoride;trifluoromethanesulfonic acid (PubChem CID 175317208) has the molecular formula C4H5F5N2O5S2
and a molecular weight of 320.22 g/mol. Its IUPAC name is 1H-imidazole;sulfuryl difluoride;trifluoromethanesulfonic acid.
Molecular Properties
| Compound Name | 1H-imidazole;sulfuryl difluoride;trifluoromethanesulfonic acid |
| PubChem CID | 175317208 |
| Molecular Formula | C4H5F5N2O5S2 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.96 |
| IUPAC Name | 1H-imidazole;sulfuryl difluoride;trifluoromethanesulfonic acid |
| SMILES | O=S(=O)(F)F.O=S(=O)(O)C(F)(F)F.c1c[nH]cn1 |
| InChI | InChI=1S/C3H4N2.CHF3O3S.F2O2S/c1-2-5-3-4-1;2-1(3,4)8(5,6)7;1-5(2,3)4/h1-3H,(H,4,5);(H,5,6,7); |
| InChIKey | KBYCWIDPMFEZTA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 117.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 1H-imidazole;sulfuryl difluoride;trifluoromethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazole;sulfuryl difluoride;trifluoromethanesulfonic acid?
The IUPAC name of 1H-imidazole;sulfuryl difluoride;trifluoromethanesulfonic acid (CID 175317208) is 1H-imidazole;sulfuryl difluoride;trifluoromethanesulfonic acid.
What is the SMILES notation for 1H-imidazole;sulfuryl difluoride;trifluoromethanesulfonic acid?
The canonical SMILES for 1H-imidazole;sulfuryl difluoride;trifluoromethanesulfonic acid is O=S(=O)(F)F.O=S(=O)(O)C(F)(F)F.c1c[nH]cn1.
What is the InChIKey of 1H-imidazole;sulfuryl difluoride;trifluoromethanesulfonic acid?
The InChIKey is KBYCWIDPMFEZTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2.CHF3O3S.F2O2S/c1-2-5-3-4-1;2-1(3,4)8(5,6)7;1-5(2,3)4/h1-3H,(H,4,5);(H,5,6,7);.
What are the key properties of 1H-imidazole;sulfuryl difluoride;trifluoromethanesulfonic acid?
1H-imidazole;sulfuryl difluoride;trifluoromethanesulfonic acid has a molecular weight of 320.22 g/mol, XLogP of 0.97, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazole;sulfuryl difluoride;trifluoromethanesulfonic acid is sourced from PubChem (CID 175317208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).