C7H5F9N2O3S — CID 171922611
1H-imidazole;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid (PubChem CID 171922611) has the molecular formula C7H5F9N2O3S and a molecular weight of 368.18 g/mol. Its IUPAC name is 1H-imidazole;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid.
| Compound Name | 1H-imidazole;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 171922611 |
| Molecular Formula | C7H5F9N2O3S |
| Molecular Weight | 368.18 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | 1H-imidazole;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.c1c[nH]cn1 |
| InChI | InChI=1S/C4HF9O3S.C3H4N2/c5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16;1-2-5-3-4-1/h(H,14,15,16);1-3H,(H,4,5) |
| InChIKey | TYTPXMXMCVKLPR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.18 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|