C11H18F6N4O6S2 — CID 161057242
1-ethyl-3-methyl-2H-imidazole;1H-imidazole;bis(trifluoromethanesulfonic acid) (PubChem CID 161057242) has the molecular formula C11H18F6N4O6S2 and a molecular weight of 480.41 g/mol. Its IUPAC name is 1-ethyl-3-methyl-2H-imidazole;1H-imidazole;bis(trifluoromethanesulfonic acid).
| Compound Name | 1-ethyl-3-methyl-2H-imidazole;1H-imidazole;bis(trifluoromethanesulfonic acid) |
|---|---|
| PubChem CID | 161057242 |
| Molecular Formula | C11H18F6N4O6S2 |
| Molecular Weight | 480.41 g/mol |
| Exact Mass | 480.06 |
| IUPAC Name | 1-ethyl-3-methyl-2H-imidazole;1H-imidazole;bis(trifluoromethanesulfonic acid) |
| SMILES | CCN1C=CN(C)C1.O=S(=O)(O)C(F)(F)F.O=S(=O)(O)C(F)(F)F.c1c[nH]cn1 |
| InChI | InChI=1S/C6H12N2.C3H4N2.2CHF3O3S/c1-3-8-5-4-7(2)6-8;1-2-5-3-4-1;2*2-1(3,4)8(5,6)7/h4-5H,3,6H2,1-2H3;1-3H,(H,4,5);2*(H,5,6,7) |
| InChIKey | UCXIZMRPKLEIHT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 143.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.41 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|