C10H19F3N2O3S — CID 175178099
1-ethyl-3-methyl-2H-imidazole;1,1,2-trifluorobutane-1-sulfonic acid (PubChem CID 175178099) has the molecular formula C10H19F3N2O3S and a molecular weight of 304.33 g/mol. Its IUPAC name is 1-ethyl-3-methyl-2H-imidazole;1,1,2-trifluorobutane-1-sulfonic acid.
| Compound Name | 1-ethyl-3-methyl-2H-imidazole;1,1,2-trifluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 175178099 |
| Molecular Formula | C10H19F3N2O3S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 1-ethyl-3-methyl-2H-imidazole;1,1,2-trifluorobutane-1-sulfonic acid |
| SMILES | CCC(F)C(F)(F)S(=O)(=O)O.CCN1C=CN(C)C1 |
| InChI | InChI=1S/C6H12N2.C4H7F3O3S/c1-3-8-5-4-7(2)6-8;1-2-3(5)4(6,7)11(8,9)10/h4-5H,3,6H2,1-2H3;3H,2H2,1H3,(H,8,9,10) |
| InChIKey | UTSLZZIJMQBSSK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|