C7H13F3N2O4S — CID 174548173
2-(3-methyl-2H-imidazol-1-yl)ethanol;trifluoromethanesulfonic acid (PubChem CID 174548173) has the molecular formula C7H13F3N2O4S and a molecular weight of 278.25 g/mol. Its IUPAC name is 2-(3-methyl-2H-imidazol-1-yl)ethanol;trifluoromethanesulfonic acid.
| Compound Name | 2-(3-methyl-2H-imidazol-1-yl)ethanol;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 174548173 |
| Molecular Formula | C7H13F3N2O4S |
| Molecular Weight | 278.25 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 2-(3-methyl-2H-imidazol-1-yl)ethanol;trifluoromethanesulfonic acid |
| SMILES | CN1C=CN(CCO)C1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C6H12N2O.CHF3O3S/c1-7-2-3-8(6-7)4-5-9;2-1(3,4)8(5,6)7/h2-3,9H,4-6H2,1H3;(H,5,6,7) |
| InChIKey | FWJSSNRQMNVJBG-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.25 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|