C14H27F3N2O3S — CID 175288173
1,3-bis(3-methylbutyl)-2H-imidazole;trifluoromethanesulfonic acid (PubChem CID 175288173) has the molecular formula C14H27F3N2O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is 1,3-bis(3-methylbutyl)-2H-imidazole;trifluoromethanesulfonic acid.
| Compound Name | 1,3-bis(3-methylbutyl)-2H-imidazole;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 175288173 |
| Molecular Formula | C14H27F3N2O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 1,3-bis(3-methylbutyl)-2H-imidazole;trifluoromethanesulfonic acid |
| SMILES | CC(C)CCN1C=CN(CCC(C)C)C1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C13H26N2.CHF3O3S/c1-12(2)5-7-14-9-10-15(11-14)8-6-13(3)4;2-1(3,4)8(5,6)7/h9-10,12-13H,5-8,11H2,1-4H3;(H,5,6,7) |
| InChIKey | AVFPYGFHAVTAMQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|