About 1-ethyl-3-methyl-2H-imidazole;quinoline;trifluoromethanesulfonic acid
1-ethyl-3-methyl-2H-imidazole;quinoline;trifluoromethanesulfonic acid (PubChem CID 175311505) has the molecular formula C16H20F3N3O3S
and a molecular weight of 391.42 g/mol. Its IUPAC name is 1-ethyl-3-methyl-2H-imidazole;quinoline;trifluoromethanesulfonic acid.
Molecular Properties
| Compound Name | 1-ethyl-3-methyl-2H-imidazole;quinoline;trifluoromethanesulfonic acid |
| PubChem CID | 175311505 |
| Molecular Formula | C16H20F3N3O3S |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 1-ethyl-3-methyl-2H-imidazole;quinoline;trifluoromethanesulfonic acid |
| SMILES | CCN1C=CN(C)C1.O=S(=O)(O)C(F)(F)F.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C6H12N2.CHF3O3S/c1-2-6-9-8(4-1)5-3-7-10-9;1-3-8-5-4-7(2)6-8;2-1(3,4)8(5,6)7/h1-7H;4-5H,3,6H2,1-2H3;(H,5,6,7) |
| InChIKey | XYDQJSRDPZTVKP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3-methyl-2H-imidazole;quinoline;trifluoromethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-methyl-2H-imidazole;quinoline;trifluoromethanesulfonic acid?
The IUPAC name of 1-ethyl-3-methyl-2H-imidazole;quinoline;trifluoromethanesulfonic acid (CID 175311505) is 1-ethyl-3-methyl-2H-imidazole;quinoline;trifluoromethanesulfonic acid.
What is the SMILES notation for 1-ethyl-3-methyl-2H-imidazole;quinoline;trifluoromethanesulfonic acid?
The canonical SMILES for 1-ethyl-3-methyl-2H-imidazole;quinoline;trifluoromethanesulfonic acid is CCN1C=CN(C)C1.O=S(=O)(O)C(F)(F)F.c1ccc2ncccc2c1.
What is the InChIKey of 1-ethyl-3-methyl-2H-imidazole;quinoline;trifluoromethanesulfonic acid?
The InChIKey is XYDQJSRDPZTVKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C6H12N2.CHF3O3S/c1-2-6-9-8(4-1)5-3-7-10-9;1-3-8-5-4-7(2)6-8;2-1(3,4)8(5,6)7/h1-7H;4-5H,3,6H2,1-2H3;(H,5,6,7).
What are the key properties of 1-ethyl-3-methyl-2H-imidazole;quinoline;trifluoromethanesulfonic acid?
1-ethyl-3-methyl-2H-imidazole;quinoline;trifluoromethanesulfonic acid has a molecular weight of 391.42 g/mol, XLogP of 3.31, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-methyl-2H-imidazole;quinoline;trifluoromethanesulfonic acid is sourced from PubChem (CID 175311505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).