About tris(1-ethyl-3-methyl-2H-imidazole);quinoline;tetrafluoroborate
tris(1-ethyl-3-methyl-2H-imidazole);quinoline;tetrafluoroborate (PubChem CID 174804773) has the molecular formula C27H43BF4N7-
and a molecular weight of 552.49 g/mol. Its IUPAC name is tris(1-ethyl-3-methyl-2H-imidazole);quinoline;tetrafluoroborate.
Molecular Properties
| Compound Name | tris(1-ethyl-3-methyl-2H-imidazole);quinoline;tetrafluoroborate |
| PubChem CID | 174804773 |
| Molecular Formula | C27H43BF4N7- |
| Molecular Weight | 552.49 g/mol |
| Exact Mass | 552.36 |
| IUPAC Name | tris(1-ethyl-3-methyl-2H-imidazole);quinoline;tetrafluoroborate |
| SMILES | CCN1C=CN(C)C1.CCN1C=CN(C)C1.CCN1C=CN(C)C1.F[B-](F)(F)F.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.3C6H12N2.BF4/c1-2-6-9-8(4-1)5-3-7-10-9;3*1-3-8-5-4-7(2)6-8;2-1(3,4)5/h1-7H;3*4-5H,3,6H2,1-2H3;/q;;;;-1 |
| InChIKey | SPQZJGGBGWRJOT-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 32.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 552.49 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tris(1-ethyl-3-methyl-2H-imidazole);quinoline;tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(1-ethyl-3-methyl-2H-imidazole);quinoline;tetrafluoroborate?
The IUPAC name of tris(1-ethyl-3-methyl-2H-imidazole);quinoline;tetrafluoroborate (CID 174804773) is tris(1-ethyl-3-methyl-2H-imidazole);quinoline;tetrafluoroborate.
What is the SMILES notation for tris(1-ethyl-3-methyl-2H-imidazole);quinoline;tetrafluoroborate?
The canonical SMILES for tris(1-ethyl-3-methyl-2H-imidazole);quinoline;tetrafluoroborate is CCN1C=CN(C)C1.CCN1C=CN(C)C1.CCN1C=CN(C)C1.F[B-](F)(F)F.c1ccc2ncccc2c1.
What is the InChIKey of tris(1-ethyl-3-methyl-2H-imidazole);quinoline;tetrafluoroborate?
The InChIKey is SPQZJGGBGWRJOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.3C6H12N2.BF4/c1-2-6-9-8(4-1)5-3-7-10-9;3*1-3-8-5-4-7(2)6-8;2-1(3,4)5/h1-7H;3*4-5H,3,6H2,1-2H3;/q;;;;-1.
What are the key properties of tris(1-ethyl-3-methyl-2H-imidazole);quinoline;tetrafluoroborate?
tris(1-ethyl-3-methyl-2H-imidazole);quinoline;tetrafluoroborate has a molecular weight of 552.49 g/mol, XLogP of 5.58, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tris(1-ethyl-3-methyl-2H-imidazole);quinoline;tetrafluoroborate is sourced from PubChem (CID 174804773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).