About 1,2-diethyl-3-methyl-2H-imidazole;quinoline
1,2-diethyl-3-methyl-2H-imidazole;quinoline (PubChem CID 159363401) has the molecular formula C17H23N3
and a molecular weight of 269.39 g/mol. Its IUPAC name is 1,2-diethyl-3-methyl-2H-imidazole;quinoline.
Molecular Properties
| Compound Name | 1,2-diethyl-3-methyl-2H-imidazole;quinoline |
| PubChem CID | 159363401 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 1,2-diethyl-3-methyl-2H-imidazole;quinoline |
| SMILES | CCC1N(C)C=CN1CC.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C8H16N2/c1-2-6-9-8(4-1)5-3-7-10-9;1-4-8-9(3)6-7-10(8)5-2/h1-7H;6-8H,4-5H2,1-3H3 |
| InChIKey | LIUWTAYBBNIZCT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,2-diethyl-3-methyl-2H-imidazole;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diethyl-3-methyl-2H-imidazole;quinoline?
The IUPAC name of 1,2-diethyl-3-methyl-2H-imidazole;quinoline (CID 159363401) is 1,2-diethyl-3-methyl-2H-imidazole;quinoline.
What is the SMILES notation for 1,2-diethyl-3-methyl-2H-imidazole;quinoline?
The canonical SMILES for 1,2-diethyl-3-methyl-2H-imidazole;quinoline is CCC1N(C)C=CN1CC.c1ccc2ncccc2c1.
What is the InChIKey of 1,2-diethyl-3-methyl-2H-imidazole;quinoline?
The InChIKey is LIUWTAYBBNIZCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C8H16N2/c1-2-6-9-8(4-1)5-3-7-10-9;1-4-8-9(3)6-7-10(8)5-2/h1-7H;6-8H,4-5H2,1-3H3.
What are the key properties of 1,2-diethyl-3-methyl-2H-imidazole;quinoline?
1,2-diethyl-3-methyl-2H-imidazole;quinoline has a molecular weight of 269.39 g/mol, XLogP of 3.70, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diethyl-3-methyl-2H-imidazole;quinoline is sourced from PubChem (CID 159363401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).