About 1,3-dibutyl-2H-imidazole-2-carbaldehyde;quinoline
1,3-dibutyl-2H-imidazole-2-carbaldehyde;quinoline (PubChem CID 174389939) has the molecular formula C21H29N3O
and a molecular weight of 339.48 g/mol. Its IUPAC name is 1,3-dibutyl-2H-imidazole-2-carbaldehyde;quinoline.
Molecular Properties
| Compound Name | 1,3-dibutyl-2H-imidazole-2-carbaldehyde;quinoline |
| PubChem CID | 174389939 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | 1,3-dibutyl-2H-imidazole-2-carbaldehyde;quinoline |
| SMILES | CCCCN1C=CN(CCCC)C1C=O.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C12H22N2O.C9H7N/c1-3-5-7-13-9-10-14(8-6-4-2)12(13)11-15;1-2-6-9-8(4-1)5-3-7-10-9/h9-12H,3-8H2,1-2H3;1-7H |
| InChIKey | LCOVIQNTARKWEJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dibutyl-2H-imidazole-2-carbaldehyde;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dibutyl-2H-imidazole-2-carbaldehyde;quinoline?
The IUPAC name of 1,3-dibutyl-2H-imidazole-2-carbaldehyde;quinoline (CID 174389939) is 1,3-dibutyl-2H-imidazole-2-carbaldehyde;quinoline.
What is the SMILES notation for 1,3-dibutyl-2H-imidazole-2-carbaldehyde;quinoline?
The canonical SMILES for 1,3-dibutyl-2H-imidazole-2-carbaldehyde;quinoline is CCCCN1C=CN(CCCC)C1C=O.c1ccc2ncccc2c1.
What is the InChIKey of 1,3-dibutyl-2H-imidazole-2-carbaldehyde;quinoline?
The InChIKey is LCOVIQNTARKWEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O.C9H7N/c1-3-5-7-13-9-10-14(8-6-4-2)12(13)11-15;1-2-6-9-8(4-1)5-3-7-10-9/h9-12H,3-8H2,1-2H3;1-7H.
What are the key properties of 1,3-dibutyl-2H-imidazole-2-carbaldehyde;quinoline?
1,3-dibutyl-2H-imidazole-2-carbaldehyde;quinoline has a molecular weight of 339.48 g/mol, XLogP of 4.44, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dibutyl-2H-imidazole-2-carbaldehyde;quinoline is sourced from PubChem (CID 174389939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).