About quinoline;5H-tetrazole-5-carbaldehyde
quinoline;5H-tetrazole-5-carbaldehyde (PubChem CID 174296767) has the molecular formula C11H9N5O
and a molecular weight of 227.23 g/mol. Its IUPAC name is quinoline;5H-tetrazole-5-carbaldehyde.
Molecular Properties
| Compound Name | quinoline;5H-tetrazole-5-carbaldehyde |
| PubChem CID | 174296767 |
| Molecular Formula | C11H9N5O |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | quinoline;5H-tetrazole-5-carbaldehyde |
| SMILES | O=CC1N=NN=N1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C2H2N4O/c1-2-6-9-8(4-1)5-3-7-10-9;7-1-2-3-5-6-4-2/h1-7H;1-2H |
| InChIKey | GJZBTCNACVYYAB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 79.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze quinoline;5H-tetrazole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoline;5H-tetrazole-5-carbaldehyde?
The IUPAC name of quinoline;5H-tetrazole-5-carbaldehyde (CID 174296767) is quinoline;5H-tetrazole-5-carbaldehyde.
What is the SMILES notation for quinoline;5H-tetrazole-5-carbaldehyde?
The canonical SMILES for quinoline;5H-tetrazole-5-carbaldehyde is O=CC1N=NN=N1.c1ccc2ncccc2c1.
What is the InChIKey of quinoline;5H-tetrazole-5-carbaldehyde?
The InChIKey is GJZBTCNACVYYAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C2H2N4O/c1-2-6-9-8(4-1)5-3-7-10-9;7-1-2-3-5-6-4-2/h1-7H;1-2H.
What are the key properties of quinoline;5H-tetrazole-5-carbaldehyde?
quinoline;5H-tetrazole-5-carbaldehyde has a molecular weight of 227.23 g/mol, XLogP of 2.58, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for quinoline;5H-tetrazole-5-carbaldehyde is sourced from PubChem (CID 174296767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).