C50H42N2 — CID 175318072
4-methyl-N-[4-[2-[4-[1-(4-methyl-N-(4-methylphenyl)anilino)-2-phenylethenyl]phenyl]ethynyl]phenyl]-N-(4-methylphenyl)aniline (PubChem CID 175318072) has the molecular formula C50H42N2 and a molecular weight of 670.90 g/mol. Its IUPAC name is 4-methyl-N-[4-[2-[4-[1-(4-methyl-N-(4-methylphenyl)anilino)-2-phenylethenyl]phenyl]ethynyl]phenyl]-N-(4-methylphenyl)aniline.
| Compound Name | 4-methyl-N-[4-[2-[4-[1-(4-methyl-N-(4-methylphenyl)anilino)-2-phenylethenyl]phenyl]ethynyl]phenyl]-N-(4-methylphenyl)aniline |
|---|---|
| PubChem CID | 175318072 |
| Molecular Formula | C50H42N2 |
| Molecular Weight | 670.90 g/mol |
| Exact Mass | 670.33 |
| IUPAC Name | 4-methyl-N-[4-[2-[4-[1-(4-methyl-N-(4-methylphenyl)anilino)-2-phenylethenyl]phenyl]ethynyl]phenyl]-N-(4-methylphenyl)aniline |
| SMILES | Cc1ccc(N(C(=Cc2ccccc2)c2ccc(C#Cc3ccc(N(c4ccc(C)cc4)c4ccc(C)cc4)cc3)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C50H42N2/c1-37-10-26-45(27-11-37)51(46-28-12-38(2)13-29-46)47-34-22-42(23-35-47)19-18-41-20-24-44(25-21-41)50(36-43-8-6-5-7-9-43)52(48-30-14-39(3)15-31-48)49-32-16-40(4)17-33-49/h5-17,20-36H,1-4H3 |
| InChIKey | CNCRXYOGBCVPNA-UHFFFAOYSA-N |
| XLogP | 13.13 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.90 |
| LogP ≤ 5 | 13.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|