C11H12N4O2 — CID 175320045
amino-(4-methyl-5-phenyl-1H-pyrazol-3-yl)carbamic acid (PubChem CID 175320045) has the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. Its IUPAC name is amino-(4-methyl-5-phenyl-1H-pyrazol-3-yl)carbamic acid.
| Compound Name | amino-(4-methyl-5-phenyl-1H-pyrazol-3-yl)carbamic acid |
|---|---|
| PubChem CID | 175320045 |
| Molecular Formula | C11H12N4O2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | amino-(4-methyl-5-phenyl-1H-pyrazol-3-yl)carbamic acid |
| SMILES | Cc1c(N(N)C(=O)O)n[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C11H12N4O2/c1-7-9(8-5-3-2-4-6-8)13-14-10(7)15(12)11(16)17/h2-6H,12H2,1H3,(H,13,14)(H,16,17) |
| InChIKey | YSGIAVGNKRJRPH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 95.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|