About 2-benzylidenepropanedinitrile;1-chloropentane
2-benzylidenepropanedinitrile;1-chloropentane (PubChem CID 175325139) has the molecular formula C15H17ClN2
and a molecular weight of 260.77 g/mol. Its IUPAC name is 2-benzylidenepropanedinitrile;1-chloropentane.
Molecular Properties
| Compound Name | 2-benzylidenepropanedinitrile;1-chloropentane |
| PubChem CID | 175325139 |
| Molecular Formula | C15H17ClN2 |
| Molecular Weight | 260.77 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2-benzylidenepropanedinitrile;1-chloropentane |
| SMILES | CCCCCCl.N#CC(C#N)=Cc1ccccc1 |
| InChI | InChI=1S/C10H6N2.C5H11Cl/c11-7-10(8-12)6-9-4-2-1-3-5-9;1-2-3-4-5-6/h1-6H;2-5H2,1H3 |
| InChIKey | BMULDFJHSBAUBM-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.77 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-benzylidenepropanedinitrile;1-chloropentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylidenepropanedinitrile;1-chloropentane?
The IUPAC name of 2-benzylidenepropanedinitrile;1-chloropentane (CID 175325139) is 2-benzylidenepropanedinitrile;1-chloropentane.
What is the SMILES notation for 2-benzylidenepropanedinitrile;1-chloropentane?
The canonical SMILES for 2-benzylidenepropanedinitrile;1-chloropentane is CCCCCCl.N#CC(C#N)=Cc1ccccc1.
What is the InChIKey of 2-benzylidenepropanedinitrile;1-chloropentane?
The InChIKey is BMULDFJHSBAUBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N2.C5H11Cl/c11-7-10(8-12)6-9-4-2-1-3-5-9;1-2-3-4-5-6/h1-6H;2-5H2,1H3.
What are the key properties of 2-benzylidenepropanedinitrile;1-chloropentane?
2-benzylidenepropanedinitrile;1-chloropentane has a molecular weight of 260.77 g/mol, XLogP of 4.53, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylidenepropanedinitrile;1-chloropentane is sourced from PubChem (CID 175325139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).