C15H30NO6P — CID 175328593
ethyl [6-(2-methylprop-2-enoyloxy)-4-(trimethylazaniumyl)hexyl] phosphate (PubChem CID 175328593) has the molecular formula C15H30NO6P and a molecular weight of 351.38 g/mol. Its IUPAC name is ethyl [6-(2-methylprop-2-enoyloxy)-4-(trimethylazaniumyl)hexyl] phosphate.
| Compound Name | ethyl [6-(2-methylprop-2-enoyloxy)-4-(trimethylazaniumyl)hexyl] phosphate |
|---|---|
| PubChem CID | 175328593 |
| Molecular Formula | C15H30NO6P |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | ethyl [6-(2-methylprop-2-enoyloxy)-4-(trimethylazaniumyl)hexyl] phosphate |
| SMILES | C=C(C)C(=O)OCCC(CCCOP(=O)([O-])OCC)[N+](C)(C)C |
| InChI | InChI=1S/C15H30NO6P/c1-7-21-23(18,19)22-11-8-9-14(16(4,5)6)10-12-20-15(17)13(2)3/h14H,2,7-12H2,1,3-6H3 |
| InChIKey | MPGOLEWWGMNKIZ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|