C9H9Cl2OZr- — CID 175334849
2-cyclopenta-1,4-dien-1-ylfuran;zirconium;dihydrochloride (PubChem CID 175334849) has the molecular formula C9H9Cl2OZr- and a molecular weight of 295.30 g/mol. Its IUPAC name is 2-cyclopenta-1,4-dien-1-ylfuran;zirconium;dihydrochloride.
| Compound Name | 2-cyclopenta-1,4-dien-1-ylfuran;zirconium;dihydrochloride |
|---|---|
| PubChem CID | 175334849 |
| Molecular Formula | C9H9Cl2OZr- |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 292.91 |
| IUPAC Name | 2-cyclopenta-1,4-dien-1-ylfuran;zirconium;dihydrochloride |
| SMILES | Cl.Cl.[C-]1=C(c2ccco2)C=CC1.[Zr] |
| InChI | InChI=1S/C9H7O.2ClH.Zr/c1-2-5-8(4-1)9-6-3-7-10-9;;;/h1,3-4,6-7H,2H2;2*1H;/q-1;;; |
| InChIKey | VWETYKBDHMHSBQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|