C23H18F2N4S — CID 175335064
5-[5-[(3,3-difluoropyrrolidin-1-yl)methyl]-3-pyridinyl]-3-(2-thiophen-3-ylethynyl)-2H-indazole (PubChem CID 175335064) has the molecular formula C23H18F2N4S and a molecular weight of 420.49 g/mol. Its IUPAC name is 5-[5-[(3,3-difluoropyrrolidin-1-yl)methyl]-3-pyridinyl]-3-(2-thiophen-3-ylethynyl)-2H-indazole.
| Compound Name | 5-[5-[(3,3-difluoropyrrolidin-1-yl)methyl]-3-pyridinyl]-3-(2-thiophen-3-ylethynyl)-2H-indazole |
|---|---|
| PubChem CID | 175335064 |
| Molecular Formula | C23H18F2N4S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 5-[5-[(3,3-difluoropyrrolidin-1-yl)methyl]-3-pyridinyl]-3-(2-thiophen-3-ylethynyl)-2H-indazole |
| SMILES | FC1(F)CCN(Cc2cncc(-c3ccc4n[nH]c(C#Cc5ccsc5)c4c3)c2)C1 |
| InChI | InChI=1S/C23H18F2N4S/c24-23(25)6-7-29(15-23)13-17-9-19(12-26-11-17)18-2-4-22-20(10-18)21(27-28-22)3-1-16-5-8-30-14-16/h2,4-5,8-12,14H,6-7,13,15H2,(H,27,28) |
| InChIKey | KHCRLYBGKQSNAI-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|