C23H38N4O11S — CID 175335290
2-[[3-methyl-2-[3-[(3-oxo-3-prop-2-enoxypropyl)-[4-oxo-4-(2-sulfoethylamino)butanoyl]amino]propanoylamino]butanoyl]amino]propanoic acid (PubChem CID 175335290) has the molecular formula C23H38N4O11S and a molecular weight of 578.64 g/mol. Its IUPAC name is 2-[[3-methyl-2-[3-[(3-oxo-3-prop-2-enoxypropyl)-[4-oxo-4-(2-sulfoethylamino)butanoyl]amino]propanoylamino]butanoyl]amino]propanoic acid.
| Compound Name | 2-[[3-methyl-2-[3-[(3-oxo-3-prop-2-enoxypropyl)-[4-oxo-4-(2-sulfoethylamino)butanoyl]amino]propanoylamino]butanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 175335290 |
| Molecular Formula | C23H38N4O11S |
| Molecular Weight | 578.64 g/mol |
| Exact Mass | 578.23 |
| IUPAC Name | 2-[[3-methyl-2-[3-[(3-oxo-3-prop-2-enoxypropyl)-[4-oxo-4-(2-sulfoethylamino)butanoyl]amino]propanoylamino]butanoyl]amino]propanoic acid |
| SMILES | C=CCOC(=O)CCN(CCC(=O)NC(C(=O)NC(C)C(=O)O)C(C)C)C(=O)CCC(=O)NCCS(=O)(=O)O |
| InChI | InChI=1S/C23H38N4O11S/c1-5-13-38-20(31)9-12-27(19(30)7-6-17(28)24-10-14-39(35,36)37)11-8-18(29)26-21(15(2)3)22(32)25-16(4)23(33)34/h5,15-16,21H,1,6-14H2,2-4H3,(H,24,28)(H,25,32)(H,26,29)(H,33,34)(H,35,36,37) |
| InChIKey | RNXOBFQSKCBXAY-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 225.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.64 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|