C19H18FNO6S — CID 175339060
1-ethyl-2-(3-fluorophenyl)-4-oxoquinoline-6-carboxylic acid;methanesulfonic acid (PubChem CID 175339060) has the molecular formula C19H18FNO6S and a molecular weight of 407.42 g/mol. Its IUPAC name is 1-ethyl-2-(3-fluorophenyl)-4-oxoquinoline-6-carboxylic acid;methanesulfonic acid.
| Compound Name | 1-ethyl-2-(3-fluorophenyl)-4-oxoquinoline-6-carboxylic acid;methanesulfonic acid |
|---|---|
| PubChem CID | 175339060 |
| Molecular Formula | C19H18FNO6S |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 1-ethyl-2-(3-fluorophenyl)-4-oxoquinoline-6-carboxylic acid;methanesulfonic acid |
| SMILES | CCn1c(-c2cccc(F)c2)cc(=O)c2cc(C(=O)O)ccc21.CS(=O)(=O)O |
| InChI | InChI=1S/C18H14FNO3.CH4O3S/c1-2-20-15-7-6-12(18(22)23)9-14(15)17(21)10-16(20)11-4-3-5-13(19)8-11;1-5(2,3)4/h3-10H,2H2,1H3,(H,22,23);1H3,(H,2,3,4) |
| InChIKey | ZLSZGFXRUUEZFG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|