C9H20N2O7 — CID 175339393
2-amino-3,3-dihydroxypropanoic acid;(2S,3S)-2-amino-3-(hydroxymethyl)pentanoic acid (PubChem CID 175339393) has the molecular formula C9H20N2O7 and a molecular weight of 268.27 g/mol. Its IUPAC name is 2-amino-3,3-dihydroxypropanoic acid;(2S,3S)-2-amino-3-(hydroxymethyl)pentanoic acid.
| Compound Name | 2-amino-3,3-dihydroxypropanoic acid;(2S,3S)-2-amino-3-(hydroxymethyl)pentanoic acid |
|---|---|
| PubChem CID | 175339393 |
| Molecular Formula | C9H20N2O7 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 2-amino-3,3-dihydroxypropanoic acid;(2S,3S)-2-amino-3-(hydroxymethyl)pentanoic acid |
| SMILES | CC[C@H](CO)[C@H](N)C(=O)O.NC(C(=O)O)C(O)O |
| InChI | InChI=1S/C6H13NO3.C3H7NO4/c1-2-4(3-8)5(7)6(9)10;4-1(2(5)6)3(7)8/h4-5,8H,2-3,7H2,1H3,(H,9,10);1-2,5-6H,4H2,(H,7,8)/t4-,5+;/m1./s1 |
| InChIKey | PBMNUSZGBCMCJI-JBUOLDKXSA-N |
| XLogP | -2.87 |
| TPSA | 187.33 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|