About acetic acid;2-methylnon-4-en-3-one;2-methyl-1-phenylpropan-2-ol
acetic acid;2-methylnon-4-en-3-one;2-methyl-1-phenylpropan-2-ol (PubChem CID 175342063) has the molecular formula C22H36O4
and a molecular weight of 364.53 g/mol. Its IUPAC name is acetic acid;2-methylnon-4-en-3-one;2-methyl-1-phenylpropan-2-ol.
Molecular Properties
| Compound Name | acetic acid;2-methylnon-4-en-3-one;2-methyl-1-phenylpropan-2-ol |
| PubChem CID | 175342063 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | acetic acid;2-methylnon-4-en-3-one;2-methyl-1-phenylpropan-2-ol |
| SMILES | CC(=O)O.CC(C)(O)Cc1ccccc1.CCCCC=CC(=O)C(C)C |
| InChI | InChI=1S/C10H14O.C10H18O.C2H4O2/c1-10(2,11)8-9-6-4-3-5-7-9;1-4-5-6-7-8-10(11)9(2)3;1-2(3)4/h3-7,11H,8H2,1-2H3;7-9H,4-6H2,1-3H3;1H3,(H,3,4) |
| InChIKey | RZZWSRNJZJGVIF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;2-methylnon-4-en-3-one;2-methyl-1-phenylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;2-methylnon-4-en-3-one;2-methyl-1-phenylpropan-2-ol?
The IUPAC name of acetic acid;2-methylnon-4-en-3-one;2-methyl-1-phenylpropan-2-ol (CID 175342063) is acetic acid;2-methylnon-4-en-3-one;2-methyl-1-phenylpropan-2-ol.
What is the SMILES notation for acetic acid;2-methylnon-4-en-3-one;2-methyl-1-phenylpropan-2-ol?
The canonical SMILES for acetic acid;2-methylnon-4-en-3-one;2-methyl-1-phenylpropan-2-ol is CC(=O)O.CC(C)(O)Cc1ccccc1.CCCCC=CC(=O)C(C)C.
What is the InChIKey of acetic acid;2-methylnon-4-en-3-one;2-methyl-1-phenylpropan-2-ol?
The InChIKey is RZZWSRNJZJGVIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O.C10H18O.C2H4O2/c1-10(2,11)8-9-6-4-3-5-7-9;1-4-5-6-7-8-10(11)9(2)3;1-2(3)4/h3-7,11H,8H2,1-2H3;7-9H,4-6H2,1-3H3;1H3,(H,3,4).
What are the key properties of acetic acid;2-methylnon-4-en-3-one;2-methyl-1-phenylpropan-2-ol?
acetic acid;2-methylnon-4-en-3-one;2-methyl-1-phenylpropan-2-ol has a molecular weight of 364.53 g/mol, XLogP of 5.05, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-methylnon-4-en-3-one;2-methyl-1-phenylpropan-2-ol is sourced from PubChem (CID 175342063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).