C10H18BrN3O4 — CID 175344038
4-[[2-[(2-aminoacetyl)amino]acetyl]amino]-2-(bromomethyl)-2-methylbutanoic acid (PubChem CID 175344038) has the molecular formula C10H18BrN3O4 and a molecular weight of 324.18 g/mol. Its IUPAC name is 4-[[2-[(2-aminoacetyl)amino]acetyl]amino]-2-(bromomethyl)-2-methylbutanoic acid.
| Compound Name | 4-[[2-[(2-aminoacetyl)amino]acetyl]amino]-2-(bromomethyl)-2-methylbutanoic acid |
|---|---|
| PubChem CID | 175344038 |
| Molecular Formula | C10H18BrN3O4 |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 4-[[2-[(2-aminoacetyl)amino]acetyl]amino]-2-(bromomethyl)-2-methylbutanoic acid |
| SMILES | CC(CBr)(CCNC(=O)CNC(=O)CN)C(=O)O |
| InChI | InChI=1S/C10H18BrN3O4/c1-10(6-11,9(17)18)2-3-13-8(16)5-14-7(15)4-12/h2-6,12H2,1H3,(H,13,16)(H,14,15)(H,17,18) |
| InChIKey | ZSLHQDDEDRCILV-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|