About lithium 1-fluoroprop-2-enyl sulfate
lithium 1-fluoroprop-2-enyl sulfate (PubChem CID 175344175) has the molecular formula C3H4FLiO4S
and a molecular weight of 162.07 g/mol. Its IUPAC name is lithium 1-fluoroprop-2-enyl sulfate.
Molecular Properties
| Compound Name | lithium 1-fluoroprop-2-enyl sulfate |
| PubChem CID | 175344175 |
| Molecular Formula | C3H4FLiO4S |
| Molecular Weight | 162.07 g/mol |
| Exact Mass | 162.00 |
| IUPAC Name | lithium 1-fluoroprop-2-enyl sulfate |
| SMILES | C=CC(F)OS(=O)(=O)[O-].[Li+] |
| InChI | InChI=1S/C3H5FO4S.Li/c1-2-3(4)8-9(5,6)7;/h2-3H,1H2,(H,5,6,7);/q;+1/p-1 |
| InChIKey | CLEIIEZHCCPLCV-UHFFFAOYSA-M |
| XLogP | -3.05 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.07 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze lithium 1-fluoroprop-2-enyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 1-fluoroprop-2-enyl sulfate?
The IUPAC name of lithium 1-fluoroprop-2-enyl sulfate (CID 175344175) is lithium 1-fluoroprop-2-enyl sulfate.
What is the SMILES notation for lithium 1-fluoroprop-2-enyl sulfate?
The canonical SMILES for lithium 1-fluoroprop-2-enyl sulfate is C=CC(F)OS(=O)(=O)[O-].[Li+].
What is the InChIKey of lithium 1-fluoroprop-2-enyl sulfate?
The InChIKey is CLEIIEZHCCPLCV-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H5FO4S.Li/c1-2-3(4)8-9(5,6)7;/h2-3H,1H2,(H,5,6,7);/q;+1/p-1.
What are the key properties of lithium 1-fluoroprop-2-enyl sulfate?
lithium 1-fluoroprop-2-enyl sulfate has a molecular weight of 162.07 g/mol, XLogP of -3.05, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 1-fluoroprop-2-enyl sulfate is sourced from PubChem (CID 175344175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).