About diethoxy-methyl-phenylsilane;oxasilinane
diethoxy-methyl-phenylsilane;oxasilinane (PubChem CID 175344228) has the molecular formula C15H28O3Si2
and a molecular weight of 312.56 g/mol. Its IUPAC name is diethoxy-methyl-phenylsilane;oxasilinane.
Molecular Properties
| Compound Name | diethoxy-methyl-phenylsilane;oxasilinane |
| PubChem CID | 175344228 |
| Molecular Formula | C15H28O3Si2 |
| Molecular Weight | 312.56 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | diethoxy-methyl-phenylsilane;oxasilinane |
| SMILES | C1CC[SiH2]OC1.CCO[Si](C)(OCC)c1ccccc1 |
| InChI | InChI=1S/C11H18O2Si.C4H10OSi/c1-4-12-14(3,13-5-2)11-9-7-6-8-10-11;1-2-4-6-5-3-1/h6-10H,4-5H2,1-3H3;1-4,6H2 |
| InChIKey | KJUDNLVYVFWJLN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.56 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze diethoxy-methyl-phenylsilane;oxasilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxy-methyl-phenylsilane;oxasilinane?
The IUPAC name of diethoxy-methyl-phenylsilane;oxasilinane (CID 175344228) is diethoxy-methyl-phenylsilane;oxasilinane.
What is the SMILES notation for diethoxy-methyl-phenylsilane;oxasilinane?
The canonical SMILES for diethoxy-methyl-phenylsilane;oxasilinane is C1CC[SiH2]OC1.CCO[Si](C)(OCC)c1ccccc1.
What is the InChIKey of diethoxy-methyl-phenylsilane;oxasilinane?
The InChIKey is KJUDNLVYVFWJLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2Si.C4H10OSi/c1-4-12-14(3,13-5-2)11-9-7-6-8-10-11;1-2-4-6-5-3-1/h6-10H,4-5H2,1-3H3;1-4,6H2.
What are the key properties of diethoxy-methyl-phenylsilane;oxasilinane?
diethoxy-methyl-phenylsilane;oxasilinane has a molecular weight of 312.56 g/mol, XLogP of 2.34, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxy-methyl-phenylsilane;oxasilinane is sourced from PubChem (CID 175344228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).