About 2-methyl-2-phenyloxasilinane;oxasilinane
2-methyl-2-phenyloxasilinane;oxasilinane (PubChem CID 174848952) has the molecular formula C15H26O2Si2
and a molecular weight of 294.54 g/mol. Its IUPAC name is 2-methyl-2-phenyloxasilinane;oxasilinane.
Molecular Properties
| Compound Name | 2-methyl-2-phenyloxasilinane;oxasilinane |
| PubChem CID | 174848952 |
| Molecular Formula | C15H26O2Si2 |
| Molecular Weight | 294.54 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 2-methyl-2-phenyloxasilinane;oxasilinane |
| SMILES | C1CC[SiH2]OC1.C[Si]1(c2ccccc2)CCCCO1 |
| InChI | InChI=1S/C11H16OSi.C4H10OSi/c1-13(10-6-5-9-12-13)11-7-3-2-4-8-11;1-2-4-6-5-3-1/h2-4,7-8H,5-6,9-10H2,1H3;1-4,6H2 |
| InChIKey | MVWNWUISBOVBHP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.54 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-2-phenyloxasilinane;oxasilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-phenyloxasilinane;oxasilinane?
The IUPAC name of 2-methyl-2-phenyloxasilinane;oxasilinane (CID 174848952) is 2-methyl-2-phenyloxasilinane;oxasilinane.
What is the SMILES notation for 2-methyl-2-phenyloxasilinane;oxasilinane?
The canonical SMILES for 2-methyl-2-phenyloxasilinane;oxasilinane is C1CC[SiH2]OC1.C[Si]1(c2ccccc2)CCCCO1.
What is the InChIKey of 2-methyl-2-phenyloxasilinane;oxasilinane?
The InChIKey is MVWNWUISBOVBHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16OSi.C4H10OSi/c1-13(10-6-5-9-12-13)11-7-3-2-4-8-11;1-2-4-6-5-3-1/h2-4,7-8H,5-6,9-10H2,1H3;1-4,6H2.
What are the key properties of 2-methyl-2-phenyloxasilinane;oxasilinane?
2-methyl-2-phenyloxasilinane;oxasilinane has a molecular weight of 294.54 g/mol, XLogP of 2.58, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-phenyloxasilinane;oxasilinane is sourced from PubChem (CID 174848952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).