C15H26OSi2 — CID 174740167
2,2-dimethyloxasilinane;phenyl(prop-2-enyl)silane (PubChem CID 174740167) has the molecular formula C15H26OSi2 and a molecular weight of 278.54 g/mol. Its IUPAC name is 2,2-dimethyloxasilinane;phenyl(prop-2-enyl)silane.
| Compound Name | 2,2-dimethyloxasilinane;phenyl(prop-2-enyl)silane |
|---|---|
| PubChem CID | 174740167 |
| Molecular Formula | C15H26OSi2 |
| Molecular Weight | 278.54 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 2,2-dimethyloxasilinane;phenyl(prop-2-enyl)silane |
| SMILES | C=CC[SiH2]c1ccccc1.C[Si]1(C)CCCCO1 |
| InChI | InChI=1S/C9H12Si.C6H14OSi/c1-2-8-10-9-6-4-3-5-7-9;1-8(2)6-4-3-5-7-8/h2-7H,1,8,10H2;3-6H2,1-2H3 |
| InChIKey | YDGPRQZKKJHCOX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.54 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|