About 2,2-dimethyloxasilinane;phenyl(prop-2-enyl)silane
2,2-dimethyloxasilinane;phenyl(prop-2-enyl)silane (PubChem CID 174740167) has the molecular formula C15H26OSi2
and a molecular weight of 278.54 g/mol. Its IUPAC name is 2,2-dimethyloxasilinane;phenyl(prop-2-enyl)silane.
Molecular Properties
| Compound Name | 2,2-dimethyloxasilinane;phenyl(prop-2-enyl)silane |
| PubChem CID | 174740167 |
| Molecular Formula | C15H26OSi2 |
| Molecular Weight | 278.54 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 2,2-dimethyloxasilinane;phenyl(prop-2-enyl)silane |
| SMILES | C=CC[SiH2]c1ccccc1.C[Si]1(C)CCCCO1 |
| InChI | InChI=1S/C9H12Si.C6H14OSi/c1-2-8-10-9-6-4-3-5-7-9;1-8(2)6-4-3-5-7-8/h2-7H,1,8,10H2;3-6H2,1-2H3 |
| InChIKey | YDGPRQZKKJHCOX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.54 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyloxasilinane;phenyl(prop-2-enyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyloxasilinane;phenyl(prop-2-enyl)silane?
The IUPAC name of 2,2-dimethyloxasilinane;phenyl(prop-2-enyl)silane (CID 174740167) is 2,2-dimethyloxasilinane;phenyl(prop-2-enyl)silane.
What is the SMILES notation for 2,2-dimethyloxasilinane;phenyl(prop-2-enyl)silane?
The canonical SMILES for 2,2-dimethyloxasilinane;phenyl(prop-2-enyl)silane is C=CC[SiH2]c1ccccc1.C[Si]1(C)CCCCO1.
What is the InChIKey of 2,2-dimethyloxasilinane;phenyl(prop-2-enyl)silane?
The InChIKey is YDGPRQZKKJHCOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12Si.C6H14OSi/c1-2-8-10-9-6-4-3-5-7-9;1-8(2)6-4-3-5-7-8/h2-7H,1,8,10H2;3-6H2,1-2H3.
What are the key properties of 2,2-dimethyloxasilinane;phenyl(prop-2-enyl)silane?
2,2-dimethyloxasilinane;phenyl(prop-2-enyl)silane has a molecular weight of 278.54 g/mol, XLogP of 3.09, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyloxasilinane;phenyl(prop-2-enyl)silane is sourced from PubChem (CID 174740167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).