C19H24N2S — CID 175345142
1-(2-ethyl-6-methylphenyl)-1-(2,4,6-trimethylphenyl)thiourea (PubChem CID 175345142) has the molecular formula C19H24N2S and a molecular weight of 312.48 g/mol. Its IUPAC name is 1-(2-ethyl-6-methylphenyl)-1-(2,4,6-trimethylphenyl)thiourea.
| Compound Name | 1-(2-ethyl-6-methylphenyl)-1-(2,4,6-trimethylphenyl)thiourea |
|---|---|
| PubChem CID | 175345142 |
| Molecular Formula | C19H24N2S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 1-(2-ethyl-6-methylphenyl)-1-(2,4,6-trimethylphenyl)thiourea |
| SMILES | CCc1cccc(C)c1N(C(N)=S)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C19H24N2S/c1-6-16-9-7-8-13(3)18(16)21(19(20)22)17-14(4)10-12(2)11-15(17)5/h7-11H,6H2,1-5H3,(H2,20,22) |
| InChIKey | TXDLSGFPCMWHBP-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|