C14H7ClNO4S- — CID 175347098
4-chloro-1,3-dioxo-5-phenylisoindole-2-sulfinate (PubChem CID 175347098) has the molecular formula C14H7ClNO4S- and a molecular weight of 320.73 g/mol. Its IUPAC name is 4-chloro-1,3-dioxo-5-phenylisoindole-2-sulfinate.
| Compound Name | 4-chloro-1,3-dioxo-5-phenylisoindole-2-sulfinate |
|---|---|
| PubChem CID | 175347098 |
| Molecular Formula | C14H7ClNO4S- |
| Molecular Weight | 320.73 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | 4-chloro-1,3-dioxo-5-phenylisoindole-2-sulfinate |
| SMILES | O=C1c2ccc(-c3ccccc3)c(Cl)c2C(=O)N1S(=O)[O-] |
| InChI | InChI=1S/C14H8ClNO4S/c15-12-9(8-4-2-1-3-5-8)6-7-10-11(12)14(18)16(13(10)17)21(19)20/h1-7H,(H,19,20)/p-1 |
| InChIKey | HZFWRXHTVMRVJW-UHFFFAOYSA-M |
| XLogP | 2.40 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.73 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|