About 1,2-dichloro-3-(phenylmethyl)benzene;zirconium
1,2-dichloro-3-(phenylmethyl)benzene;zirconium (PubChem CID 175349051) has the molecular formula C13H9Cl2Zr-
and a molecular weight of 327.35 g/mol. Its IUPAC name is 1,2-dichloro-3-(phenylmethyl)benzene;zirconium.
Molecular Properties
| Compound Name | 1,2-dichloro-3-(phenylmethyl)benzene;zirconium |
| PubChem CID | 175349051 |
| Molecular Formula | C13H9Cl2Zr- |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 324.91 |
| IUPAC Name | 1,2-dichloro-3-(phenylmethyl)benzene;zirconium |
| SMILES | Clc1cccc([CH-]c2ccccc2)c1Cl.[Zr] |
| InChI | InChI=1S/C13H9Cl2.Zr/c14-12-8-4-7-11(13(12)15)9-10-5-2-1-3-6-10;/h1-9H;/q-1; |
| InChIKey | UGJAYPRAFKBKMU-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dichloro-3-(phenylmethyl)benzene;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichloro-3-(phenylmethyl)benzene;zirconium?
The IUPAC name of 1,2-dichloro-3-(phenylmethyl)benzene;zirconium (CID 175349051) is 1,2-dichloro-3-(phenylmethyl)benzene;zirconium.
What is the SMILES notation for 1,2-dichloro-3-(phenylmethyl)benzene;zirconium?
The canonical SMILES for 1,2-dichloro-3-(phenylmethyl)benzene;zirconium is Clc1cccc([CH-]c2ccccc2)c1Cl.[Zr].
What is the InChIKey of 1,2-dichloro-3-(phenylmethyl)benzene;zirconium?
The InChIKey is UGJAYPRAFKBKMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9Cl2.Zr/c14-12-8-4-7-11(13(12)15)9-10-5-2-1-3-6-10;/h1-9H;/q-1;.
What are the key properties of 1,2-dichloro-3-(phenylmethyl)benzene;zirconium?
1,2-dichloro-3-(phenylmethyl)benzene;zirconium has a molecular weight of 327.35 g/mol, XLogP of 4.59, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichloro-3-(phenylmethyl)benzene;zirconium is sourced from PubChem (CID 175349051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).