C10H11Cl2N — CID 130739567
(2R)-2-(2,3-dichlorophenyl)but-3-en-2-amine (PubChem CID 130739567) has the molecular formula C10H11Cl2N and a molecular weight of 216.11 g/mol. Its IUPAC name is (2R)-2-(2,3-dichlorophenyl)but-3-en-2-amine.
| Compound Name | (2R)-2-(2,3-dichlorophenyl)but-3-en-2-amine |
|---|---|
| PubChem CID | 130739567 |
| Molecular Formula | C10H11Cl2N |
| Molecular Weight | 216.11 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | (2R)-2-(2,3-dichlorophenyl)but-3-en-2-amine |
| SMILES | C=C[C@@](C)(N)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C10H11Cl2N/c1-3-10(2,13)7-5-4-6-8(11)9(7)12/h3-6H,1,13H2,2H3/t10-/m1/s1 |
| InChIKey | WBJTXMDJRWKLIO-SNVBAGLBSA-N |
| XLogP | 3.35 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.11 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|