About 2-[(2R)-2-aminobut-3-en-2-yl]-4,6-dichlorophenol
2-[(2R)-2-aminobut-3-en-2-yl]-4,6-dichlorophenol (PubChem CID 130605702) has the molecular formula C10H11Cl2NO
and a molecular weight of 232.11 g/mol. Its IUPAC name is 2-[(2R)-2-aminobut-3-en-2-yl]-4,6-dichlorophenol.
Molecular Properties
| Compound Name | 2-[(2R)-2-aminobut-3-en-2-yl]-4,6-dichlorophenol |
| PubChem CID | 130605702 |
| Molecular Formula | C10H11Cl2NO |
| Molecular Weight | 232.11 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | 2-[(2R)-2-aminobut-3-en-2-yl]-4,6-dichlorophenol |
| SMILES | C=C[C@@](C)(N)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C10H11Cl2NO/c1-3-10(2,13)7-4-6(11)5-8(12)9(7)14/h3-5,14H,1,13H2,2H3/t10-/m1/s1 |
| InChIKey | NXYPGRYFVMMHRF-SNVBAGLBSA-N |
| XLogP | 3.06 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.11 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2R)-2-aminobut-3-en-2-yl]-4,6-dichlorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R)-2-aminobut-3-en-2-yl]-4,6-dichlorophenol?
The IUPAC name of 2-[(2R)-2-aminobut-3-en-2-yl]-4,6-dichlorophenol (CID 130605702) is 2-[(2R)-2-aminobut-3-en-2-yl]-4,6-dichlorophenol.
What is the SMILES notation for 2-[(2R)-2-aminobut-3-en-2-yl]-4,6-dichlorophenol?
The canonical SMILES for 2-[(2R)-2-aminobut-3-en-2-yl]-4,6-dichlorophenol is C=C[C@@](C)(N)c1cc(Cl)cc(Cl)c1O.
What is the InChIKey of 2-[(2R)-2-aminobut-3-en-2-yl]-4,6-dichlorophenol?
The InChIKey is NXYPGRYFVMMHRF-SNVBAGLBSA-N. The full InChI is InChI=1S/C10H11Cl2NO/c1-3-10(2,13)7-4-6(11)5-8(12)9(7)14/h3-5,14H,1,13H2,2H3/t10-/m1/s1.
What are the key properties of 2-[(2R)-2-aminobut-3-en-2-yl]-4,6-dichlorophenol?
2-[(2R)-2-aminobut-3-en-2-yl]-4,6-dichlorophenol has a molecular weight of 232.11 g/mol, XLogP of 3.06, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R)-2-aminobut-3-en-2-yl]-4,6-dichlorophenol is sourced from PubChem (CID 130605702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).