C21H28N2O5 — CID 175349424
methyl (1S)-1-(2-acetamido-3-methoxy-3-oxopropyl)-2-(1-phenylethylimino)cyclopentane-1-carboxylate (PubChem CID 175349424) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is methyl (1S)-1-(2-acetamido-3-methoxy-3-oxopropyl)-2-(1-phenylethylimino)cyclopentane-1-carboxylate.
| Compound Name | methyl (1S)-1-(2-acetamido-3-methoxy-3-oxopropyl)-2-(1-phenylethylimino)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 175349424 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | methyl (1S)-1-(2-acetamido-3-methoxy-3-oxopropyl)-2-(1-phenylethylimino)cyclopentane-1-carboxylate |
| SMILES | COC(=O)C(C[C@@]1(C(=O)OC)CCC/C1=N\C(C)c1ccccc1)NC(C)=O |
| InChI | InChI=1S/C21H28N2O5/c1-14(16-9-6-5-7-10-16)22-18-11-8-12-21(18,20(26)28-4)13-17(19(25)27-3)23-15(2)24/h5-7,9-10,14,17H,8,11-13H2,1-4H3,(H,23,24)/b22-18+/t14?,17?,21-/m0/s1 |
| InChIKey | CQVPIENTPCMYLG-ZHSMDMPISA-N |
| XLogP | 2.60 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|