C20H24N2O4 — CID 175351457
tert-butyl 3-[(7-cyano-2-formyl-2,3-dihydro-1H-inden-5-yl)-hydroxymethyl]azetidine-1-carboxylate (PubChem CID 175351457) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is tert-butyl 3-[(7-cyano-2-formyl-2,3-dihydro-1H-inden-5-yl)-hydroxymethyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(7-cyano-2-formyl-2,3-dihydro-1H-inden-5-yl)-hydroxymethyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 175351457 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | tert-butyl 3-[(7-cyano-2-formyl-2,3-dihydro-1H-inden-5-yl)-hydroxymethyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(C(O)c2cc(C#N)c3c(c2)CC(C=O)C3)C1 |
| InChI | InChI=1S/C20H24N2O4/c1-20(2,3)26-19(25)22-9-16(10-22)18(24)14-6-13-4-12(11-23)5-17(13)15(7-14)8-21/h6-7,11-12,16,18,24H,4-5,9-10H2,1-3H3 |
| InChIKey | RMMKSCQSKJHJQH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|