About 5-fluoro-3,4-bis(fluoromethyl)pent-1-ene
5-fluoro-3,4-bis(fluoromethyl)pent-1-ene (PubChem CID 175351865) has the molecular formula C7H11F3
and a molecular weight of 152.16 g/mol. Its IUPAC name is 5-fluoro-3,4-bis(fluoromethyl)pent-1-ene.
Molecular Properties
| Compound Name | 5-fluoro-3,4-bis(fluoromethyl)pent-1-ene |
| PubChem CID | 175351865 |
| Molecular Formula | C7H11F3 |
| Molecular Weight | 152.16 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 5-fluoro-3,4-bis(fluoromethyl)pent-1-ene |
| SMILES | C=CC(CF)C(CF)CF |
| InChI | InChI=1S/C7H11F3/c1-2-6(3-8)7(4-9)5-10/h2,6-7H,1,3-5H2 |
| InChIKey | XXUHNRUYOKKAIN-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.16 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-3,4-bis(fluoromethyl)pent-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-3,4-bis(fluoromethyl)pent-1-ene?
The IUPAC name of 5-fluoro-3,4-bis(fluoromethyl)pent-1-ene (CID 175351865) is 5-fluoro-3,4-bis(fluoromethyl)pent-1-ene.
What is the SMILES notation for 5-fluoro-3,4-bis(fluoromethyl)pent-1-ene?
The canonical SMILES for 5-fluoro-3,4-bis(fluoromethyl)pent-1-ene is C=CC(CF)C(CF)CF.
What is the InChIKey of 5-fluoro-3,4-bis(fluoromethyl)pent-1-ene?
The InChIKey is XXUHNRUYOKKAIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F3/c1-2-6(3-8)7(4-9)5-10/h2,6-7H,1,3-5H2.
What are the key properties of 5-fluoro-3,4-bis(fluoromethyl)pent-1-ene?
5-fluoro-3,4-bis(fluoromethyl)pent-1-ene has a molecular weight of 152.16 g/mol, XLogP of 2.31, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-3,4-bis(fluoromethyl)pent-1-ene is sourced from PubChem (CID 175351865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).