About 1-ethenoxy-1,2-difluoroethane
1-ethenoxy-1,2-difluoroethane (PubChem CID 56626472) has the molecular formula C4H6F2O
and a molecular weight of 108.09 g/mol. Its IUPAC name is 1-ethenoxy-1,2-difluoroethane.
Molecular Properties
| Compound Name | 1-ethenoxy-1,2-difluoroethane |
| PubChem CID | 56626472 |
| Molecular Formula | C4H6F2O |
| Molecular Weight | 108.09 g/mol |
| Exact Mass | 108.04 |
| IUPAC Name | 1-ethenoxy-1,2-difluoroethane |
| SMILES | C=COC(F)CF |
| InChI | InChI=1S/C4H6F2O/c1-2-7-4(6)3-5/h2,4H,1,3H2 |
| InChIKey | NQPLLOTVHJZHGT-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.09 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenoxy-1,2-difluoroethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenoxy-1,2-difluoroethane?
The IUPAC name of 1-ethenoxy-1,2-difluoroethane (CID 56626472) is 1-ethenoxy-1,2-difluoroethane.
What is the SMILES notation for 1-ethenoxy-1,2-difluoroethane?
The canonical SMILES for 1-ethenoxy-1,2-difluoroethane is C=COC(F)CF.
What is the InChIKey of 1-ethenoxy-1,2-difluoroethane?
The InChIKey is NQPLLOTVHJZHGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6F2O/c1-2-7-4(6)3-5/h2,4H,1,3H2.
What are the key properties of 1-ethenoxy-1,2-difluoroethane?
1-ethenoxy-1,2-difluoroethane has a molecular weight of 108.09 g/mol, XLogP of 1.41, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenoxy-1,2-difluoroethane is sourced from PubChem (CID 56626472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).